C20H38N4O3 — CID 86999561
N,N-diethyl-4-[(1-morpholin-4-ylcyclohexyl)methylcarbamoylamino]butanamide (PubChem CID 86999561) has the molecular formula C20H38N4O3 and a molecular weight of 382.55 g/mol. Its IUPAC name is N,N-diethyl-4-[(1-morpholin-4-ylcyclohexyl)methylcarbamoylamino]butanamide.
| Compound Name | N,N-diethyl-4-[(1-morpholin-4-ylcyclohexyl)methylcarbamoylamino]butanamide |
|---|---|
| PubChem CID | 86999561 |
| Molecular Formula | C20H38N4O3 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | N,N-diethyl-4-[(1-morpholin-4-ylcyclohexyl)methylcarbamoylamino]butanamide |
| SMILES | CCN(CC)C(=O)CCCNC(=O)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C20H38N4O3/c1-3-23(4-2)18(25)9-8-12-21-19(26)22-17-20(10-6-5-7-11-20)24-13-15-27-16-14-24/h3-17H2,1-2H3,(H2,21,22,26) |
| InChIKey | URTSTAVCPVCSJG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|