C22H29N3O2S — CID 86999745
1-cyclopropyl-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-(thiophen-2-ylmethyl)urea (PubChem CID 86999745) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-cyclopropyl-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 86999745 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-cyclopropyl-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1-(thiophen-2-ylmethyl)urea |
| SMILES | COc1ccccc1C(CNC(=O)N(Cc1cccs1)C1CC1)N1CCCC1 |
| InChI | InChI=1S/C22H29N3O2S/c1-27-21-9-3-2-8-19(21)20(24-12-4-5-13-24)15-23-22(26)25(17-10-11-17)16-18-7-6-14-28-18/h2-3,6-9,14,17,20H,4-5,10-13,15-16H2,1H3,(H,23,26) |
| InChIKey | JUCJXDANWXYJSP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |