C18H24N2O3 — CID 87000120
1-methyl-3-[1-(5-methylfuran-2-yl)ethyl]-1-[2-(4-methylphenoxy)ethyl]urea (PubChem CID 87000120) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-methyl-3-[1-(5-methylfuran-2-yl)ethyl]-1-[2-(4-methylphenoxy)ethyl]urea.
| Compound Name | 1-methyl-3-[1-(5-methylfuran-2-yl)ethyl]-1-[2-(4-methylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 87000120 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-methyl-3-[1-(5-methylfuran-2-yl)ethyl]-1-[2-(4-methylphenoxy)ethyl]urea |
| SMILES | Cc1ccc(OCCN(C)C(=O)NC(C)c2ccc(C)o2)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-13-5-8-16(9-6-13)22-12-11-20(4)18(21)19-15(3)17-10-7-14(2)23-17/h5-10,15H,11-12H2,1-4H3,(H,19,21) |
| InChIKey | GPLSCUKEWDJTSO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |