C13H20F3N5O2 — CID 87000132
1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea (PubChem CID 87000132) has the molecular formula C13H20F3N5O2 and a molecular weight of 335.33 g/mol. Its IUPAC name is 1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea.
| Compound Name | 1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
|---|---|
| PubChem CID | 87000132 |
| Molecular Formula | C13H20F3N5O2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
| SMILES | O=C(NCCOCC(F)(F)F)NCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C13H20F3N5O2/c14-13(15,16)9-23-7-5-17-12(22)18-8-11-20-19-10-4-2-1-3-6-21(10)11/h1-9H2,(H2,17,18,22) |
| InChIKey | FTPZQAXXJBUIQV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|