About 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide
2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 87002249) has the molecular formula C8H8N4OS
and a molecular weight of 208.25 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 87002249 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Cn1cc(-c2nc(C(N)=O)cs2)cn1 |
| InChI | InChI=1S/C8H8N4OS/c1-12-3-5(2-10-12)8-11-6(4-14-8)7(9)13/h2-4H,1H3,(H2,9,13) |
| InChIKey | UZIDDUOXHLHQJO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide (CID 87002249) is 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide is Cn1cc(-c2nc(C(N)=O)cs2)cn1.
What is the InChIKey of 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide?
The InChIKey is UZIDDUOXHLHQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4OS/c1-12-3-5(2-10-12)8-11-6(4-14-8)7(9)13/h2-4H,1H3,(H2,9,13).
What are the key properties of 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide?
2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide has a molecular weight of 208.25 g/mol, XLogP of 0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 87002249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).