C17H31F3N4O — CID 87002659
N-[3-(4-methylpiperidin-1-yl)propyl]-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carboxamide (PubChem CID 87002659) has the molecular formula C17H31F3N4O and a molecular weight of 364.46 g/mol. Its IUPAC name is N-[3-(4-methylpiperidin-1-yl)propyl]-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-[3-(4-methylpiperidin-1-yl)propyl]-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 87002659 |
| Molecular Formula | C17H31F3N4O |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | N-[3-(4-methylpiperidin-1-yl)propyl]-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carboxamide |
| SMILES | CC1CCN(CCCNC(=O)N2CCCN(CC(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C17H31F3N4O/c1-15-4-10-22(11-5-15)7-2-6-21-16(25)24-9-3-8-23(12-13-24)14-17(18,19)20/h15H,2-14H2,1H3,(H,21,25) |
| InChIKey | RZOLLTQGBDEJHK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|