C18H35N3O3 — CID 87003458
N-(3-ethyl-2-morpholin-4-ylpentyl)-3-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 87003458) has the molecular formula C18H35N3O3 and a molecular weight of 341.50 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-3-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-3-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 87003458 |
| Molecular Formula | C18H35N3O3 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-3-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | CCC(CC)C(CNC(=O)N1CCCC(CO)C1)N1CCOCC1 |
| InChI | InChI=1S/C18H35N3O3/c1-3-16(4-2)17(20-8-10-24-11-9-20)12-19-18(23)21-7-5-6-15(13-21)14-22/h15-17,22H,3-14H2,1-2H3,(H,19,23) |
| InChIKey | PSEMDNRONFJBSS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |