C20H23NO5 — CID 87005207
2-(4-acetyl-2-methoxyphenoxy)-N-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]acetamide (PubChem CID 87005207) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-N-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]acetamide.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-N-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 87005207 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-N-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]acetamide |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)N(Cc1ccc(C)o1)C1CC1 |
| InChI | InChI=1S/C20H23NO5/c1-13-4-8-17(26-13)11-21(16-6-7-16)20(23)12-25-18-9-5-15(14(2)22)10-19(18)24-3/h4-5,8-10,16H,6-7,11-12H2,1-3H3 |
| InChIKey | UUMVOLGYNIBFNM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |