C18H33F3N4O — CID 87006993
N-[4-(2-methylpiperidin-1-yl)butyl]-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carboxamide (PubChem CID 87006993) has the molecular formula C18H33F3N4O and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[4-(2-methylpiperidin-1-yl)butyl]-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-[4-(2-methylpiperidin-1-yl)butyl]-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 87006993 |
| Molecular Formula | C18H33F3N4O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | N-[4-(2-methylpiperidin-1-yl)butyl]-4-(2,2,2-trifluoroethyl)-1,4-diazepane-1-carboxamide |
| SMILES | CC1CCCCN1CCCCNC(=O)N1CCCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H33F3N4O/c1-16-7-2-4-10-24(16)11-5-3-8-22-17(26)25-12-6-9-23(13-14-25)15-18(19,20)21/h16H,2-15H2,1H3,(H,22,26) |
| InChIKey | GIFHBYOGPUSNTA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|