C14H20Cl2N4O2 — CID 87007350
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2,2-dimethylmorpholine-4-carboxamide (PubChem CID 87007350) has the molecular formula C14H20Cl2N4O2 and a molecular weight of 347.25 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2,2-dimethylmorpholine-4-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2,2-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 87007350 |
| Molecular Formula | C14H20Cl2N4O2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2,2-dimethylmorpholine-4-carboxamide |
| SMILES | CC1(C)CN(C(=O)NCCNc2ncc(Cl)cc2Cl)CCO1 |
| InChI | InChI=1S/C14H20Cl2N4O2/c1-14(2)9-20(5-6-22-14)13(21)18-4-3-17-12-11(16)7-10(15)8-19-12/h7-8H,3-6,9H2,1-2H3,(H,17,19)(H,18,21) |
| InChIKey | RTWJSHBPALRNJN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|