C14H21N7O — CID 87007937
1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-3-(pyrimidin-2-ylamino)urea (PubChem CID 87007937) has the molecular formula C14H21N7O and a molecular weight of 303.37 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-3-(pyrimidin-2-ylamino)urea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-3-(pyrimidin-2-ylamino)urea |
|---|---|
| PubChem CID | 87007937 |
| Molecular Formula | C14H21N7O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-3-(pyrimidin-2-ylamino)urea |
| SMILES | Cc1cc(C)n(CC(C)CNC(=O)NNc2ncccn2)n1 |
| InChI | InChI=1S/C14H21N7O/c1-10(9-21-12(3)7-11(2)20-21)8-17-14(22)19-18-13-15-5-4-6-16-13/h4-7,10H,8-9H2,1-3H3,(H,15,16,18)(H2,17,19,22) |
| InChIKey | YBBKQOJUWNPSEO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|