C19H23NO2 — CID 87009451
3-(4-methoxyphenyl)-N-phenyl-N-propan-2-ylpropanamide (PubChem CID 87009451) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-phenyl-N-propan-2-ylpropanamide.
| Compound Name | 3-(4-methoxyphenyl)-N-phenyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 87009451 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-phenyl-N-propan-2-ylpropanamide |
| SMILES | COc1ccc(CCC(=O)N(c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-15(2)20(17-7-5-4-6-8-17)19(21)14-11-16-9-12-18(22-3)13-10-16/h4-10,12-13,15H,11,14H2,1-3H3 |
| InChIKey | ADDZVAJNYNMYCJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |