C21H29N5O2 — CID 87010560
4-[[2-(dimethylamino)ethyl-(pyridin-3-ylmethyl)carbamoyl]amino]-N-ethyl-3-methylbenzamide (PubChem CID 87010560) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)ethyl-(pyridin-3-ylmethyl)carbamoyl]amino]-N-ethyl-3-methylbenzamide.
| Compound Name | 4-[[2-(dimethylamino)ethyl-(pyridin-3-ylmethyl)carbamoyl]amino]-N-ethyl-3-methylbenzamide |
|---|---|
| PubChem CID | 87010560 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 4-[[2-(dimethylamino)ethyl-(pyridin-3-ylmethyl)carbamoyl]amino]-N-ethyl-3-methylbenzamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)N(CCN(C)C)Cc2cccnc2)c(C)c1 |
| InChI | InChI=1S/C21H29N5O2/c1-5-23-20(27)18-8-9-19(16(2)13-18)24-21(28)26(12-11-25(3)4)15-17-7-6-10-22-14-17/h6-10,13-14H,5,11-12,15H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | JRGBSBINCJGPSU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |