C20H18FN3O4 — CID 87010608
N-(3-fluorophenyl)-3-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzamide (PubChem CID 87010608) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzamide.
| Compound Name | N-(3-fluorophenyl)-3-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 87010608 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-(3-fluorophenyl)-3-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzamide |
| SMILES | O=C(NCC(O)c1ccco1)Nc1cccc(C(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C20H18FN3O4/c21-14-5-2-7-16(11-14)23-19(26)13-4-1-6-15(10-13)24-20(27)22-12-17(25)18-8-3-9-28-18/h1-11,17,25H,12H2,(H,23,26)(H2,22,24,27) |
| InChIKey | YCCMSLSBYZXQKH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |