C12H18N2O2 — CID 87010748
4-methoxy-N-methyl-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 87010748) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-methoxy-N-methyl-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | 4-methoxy-N-methyl-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 87010748 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-methoxy-N-methyl-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | COCCCC(=O)N(C)Cc1cccnc1 |
| InChI | InChI=1S/C12H18N2O2/c1-14(12(15)6-4-8-16-2)10-11-5-3-7-13-9-11/h3,5,7,9H,4,6,8,10H2,1-2H3 |
| InChIKey | OJXKNBZSIRHXON-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|