C18H27BrN2O — CID 87011264
(2-bromophenyl)-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]methanone (PubChem CID 87011264) has the molecular formula C18H27BrN2O and a molecular weight of 367.33 g/mol. Its IUPAC name is (2-bromophenyl)-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]methanone.
| Compound Name | (2-bromophenyl)-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 87011264 |
| Molecular Formula | C18H27BrN2O |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (2-bromophenyl)-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]methanone |
| SMILES | CCCCN(C)CC1CCN(C(=O)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C18H27BrN2O/c1-3-4-11-20(2)14-15-9-12-21(13-10-15)18(22)16-7-5-6-8-17(16)19/h5-8,15H,3-4,9-14H2,1-2H3 |
| InChIKey | ZSVLBEYDYJVNEK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |