About (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate
(3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 87011717) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate.
Molecular Properties
| Compound Name | (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate |
| PubChem CID | 87011717 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | Cc1cc(OC(=O)Cn2ccc(=O)n(C)c2=O)cc(C(C)C)c1 |
| InChI | InChI=1S/C17H20N2O4/c1-11(2)13-7-12(3)8-14(9-13)23-16(21)10-19-6-5-15(20)18(4)17(19)22/h5-9,11H,10H2,1-4H3 |
| InChIKey | MRWIEUVENMHFQD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate?
The IUPAC name of (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate (CID 87011717) is (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate.
What is the SMILES notation for (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate?
The canonical SMILES for (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate is Cc1cc(OC(=O)Cn2ccc(=O)n(C)c2=O)cc(C(C)C)c1.
What is the InChIKey of (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate?
The InChIKey is MRWIEUVENMHFQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O4/c1-11(2)13-7-12(3)8-14(9-13)23-16(21)10-19-6-5-15(20)18(4)17(19)22/h5-9,11H,10H2,1-4H3.
What are the key properties of (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate?
(3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate has a molecular weight of 316.36 g/mol, XLogP of 1.58, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-5-propan-2-ylphenyl) 2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetate is sourced from PubChem (CID 87011717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).