C19H27N3OS2 — CID 87013934
N-pentyl-1-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide (PubChem CID 87013934) has the molecular formula C19H27N3OS2 and a molecular weight of 377.58 g/mol. Its IUPAC name is N-pentyl-1-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-pentyl-1-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 87013934 |
| Molecular Formula | C19H27N3OS2 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-pentyl-1-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]piperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(Cc2csc(-c3cccs3)n2)CC1 |
| InChI | InChI=1S/C19H27N3OS2/c1-2-3-4-9-20-18(23)15-7-10-22(11-8-15)13-16-14-25-19(21-16)17-6-5-12-24-17/h5-6,12,14-15H,2-4,7-11,13H2,1H3,(H,20,23) |
| InChIKey | UFQQGDPTMUZBJW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|