C21H23FN4O2 — CID 87014714
N-[2-(3-fluorophenoxy)ethyl]-2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]acetamide (PubChem CID 87014714) has the molecular formula C21H23FN4O2 and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]acetamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 87014714 |
| Molecular Formula | C21H23FN4O2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-2-[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]acetamide |
| SMILES | CN(CC(=O)NCCOc1cccc(F)c1)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H23FN4O2/c1-25(14-17-13-24-26(15-17)19-7-3-2-4-8-19)16-21(27)23-10-11-28-20-9-5-6-18(22)12-20/h2-9,12-13,15H,10-11,14,16H2,1H3,(H,23,27) |
| InChIKey | FHKILJQCOHPONQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|