C21H36N2O2 — CID 87014881
1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-3-(4-methylphenoxy)propan-2-ol (PubChem CID 87014881) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-3-(4-methylphenoxy)propan-2-ol.
| Compound Name | 1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-3-(4-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 87014881 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 1-[4-[[butyl(methyl)amino]methyl]piperidin-1-yl]-3-(4-methylphenoxy)propan-2-ol |
| SMILES | CCCCN(C)CC1CCN(CC(O)COc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C21H36N2O2/c1-4-5-12-22(3)15-19-10-13-23(14-11-19)16-20(24)17-25-21-8-6-18(2)7-9-21/h6-9,19-20,24H,4-5,10-17H2,1-3H3 |
| InChIKey | DYCOCBGTDSZOLU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |