C17H24F3N3O2 — CID 87015064
2-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-propylamino]-N-propylacetamide (PubChem CID 87015064) has the molecular formula C17H24F3N3O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-propylamino]-N-propylacetamide.
| Compound Name | 2-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-propylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 87015064 |
| Molecular Formula | C17H24F3N3O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-propylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(CCC)CC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H24F3N3O2/c1-3-8-21-15(24)11-23(9-4-2)12-16(25)22-14-7-5-6-13(10-14)17(18,19)20/h5-7,10H,3-4,8-9,11-12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | DLEVWHCOIXAYAK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |