C23H28N2O4 — CID 87016044
2-[1-(1-benzofuran-2-yl)ethyl-methylamino]-N-[[4-(2-methoxyethoxy)phenyl]methyl]acetamide (PubChem CID 87016044) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[1-(1-benzofuran-2-yl)ethyl-methylamino]-N-[[4-(2-methoxyethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-[1-(1-benzofuran-2-yl)ethyl-methylamino]-N-[[4-(2-methoxyethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 87016044 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-[1-(1-benzofuran-2-yl)ethyl-methylamino]-N-[[4-(2-methoxyethoxy)phenyl]methyl]acetamide |
| SMILES | COCCOc1ccc(CNC(=O)CN(C)C(C)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-17(22-14-19-6-4-5-7-21(19)29-22)25(2)16-23(26)24-15-18-8-10-20(11-9-18)28-13-12-27-3/h4-11,14,17H,12-13,15-16H2,1-3H3,(H,24,26) |
| InChIKey | JQKMUABHZFTUOX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|