C21H25N7O2 — CID 87016150
1-[4-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 87016150) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is 1-[4-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | 1-[4-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 87016150 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 1-[4-(6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carbonyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | CC1CCc2[nH]c3c(C(=O)N4CCN(C(=O)Cn5cnnn5)CC4)cccc3c2C1 |
| InChI | InChI=1S/C21H25N7O2/c1-14-5-6-18-17(11-14)15-3-2-4-16(20(15)23-18)21(30)27-9-7-26(8-10-27)19(29)12-28-13-22-24-25-28/h2-4,13-14,23H,5-12H2,1H3 |
| InChIKey | RFYSYGAZKYCFAZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|