About N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine
N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine (PubChem CID 87016623) has the molecular formula C24H26N4
and a molecular weight of 370.50 g/mol. Its IUPAC name is N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine.
Molecular Properties
| Compound Name | N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine |
| PubChem CID | 87016623 |
| Molecular Formula | C24H26N4 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine |
| SMILES | Cc1nn(C)c2ncc(CN(CCc3ccccc3)Cc3ccccc3)cc12 |
| InChI | InChI=1S/C24H26N4/c1-19-23-15-22(16-25-24(23)27(2)26-19)18-28(17-21-11-7-4-8-12-21)14-13-20-9-5-3-6-10-20/h3-12,15-16H,13-14,17-18H2,1-2H3 |
| InChIKey | DCYJLMGFPGZFFI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine?
The IUPAC name of N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine (CID 87016623) is N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine.
What is the SMILES notation for N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine?
The canonical SMILES for N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine is Cc1nn(C)c2ncc(CN(CCc3ccccc3)Cc3ccccc3)cc12.
What is the InChIKey of N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine?
The InChIKey is DCYJLMGFPGZFFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N4/c1-19-23-15-22(16-25-24(23)27(2)26-19)18-28(17-21-11-7-4-8-12-21)14-13-20-9-5-3-6-10-20/h3-12,15-16H,13-14,17-18H2,1-2H3.
What are the key properties of N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine?
N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine has a molecular weight of 370.50 g/mol, XLogP of 4.52, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-2-phenylethanamine is sourced from PubChem (CID 87016623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).