C14H25N3O3 — CID 87016720
3-[3-(2,2-dimethylmorpholin-4-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 87016720) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-[3-(2,2-dimethylmorpholin-4-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[3-(2,2-dimethylmorpholin-4-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87016720 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 3-[3-(2,2-dimethylmorpholin-4-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)CN(CCCN2C(=O)NC(C)(C)C2=O)CCO1 |
| InChI | InChI=1S/C14H25N3O3/c1-13(2)10-16(8-9-20-13)6-5-7-17-11(18)14(3,4)15-12(17)19/h5-10H2,1-4H3,(H,15,19) |
| InChIKey | UFCRBZYFTSQLAK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|