C14H23F3N2O2 — CID 87017173
2-[4-(hydroxymethyl)piperidin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 87017173) has the molecular formula C14H23F3N2O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[4-(hydroxymethyl)piperidin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-[4-(hydroxymethyl)piperidin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 87017173 |
| Molecular Formula | C14H23F3N2O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-[4-(hydroxymethyl)piperidin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCC(CO)CC1)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H23F3N2O2/c15-14(16,17)12-2-1-5-19(8-12)13(21)9-18-6-3-11(10-20)4-7-18/h11-12,20H,1-10H2 |
| InChIKey | NHVVFPRHWXDCBQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |