C13H19N5O2S — CID 87018076
3-cyclopropyl-5-[1-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,2,4-oxadiazole (PubChem CID 87018076) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 3-cyclopropyl-5-[1-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,2,4-oxadiazole.
| Compound Name | 3-cyclopropyl-5-[1-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 87018076 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-cyclopropyl-5-[1-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,2,4-oxadiazole |
| SMILES | COCCCn1cnnc1SC(C)c1nc(C2CC2)no1 |
| InChI | InChI=1S/C13H19N5O2S/c1-9(12-15-11(17-20-12)10-4-5-10)21-13-16-14-8-18(13)6-3-7-19-2/h8-10H,3-7H2,1-2H3 |
| InChIKey | HYWUOBSSUINBHW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|