About 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide
2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide (PubChem CID 87018470) has the molecular formula C19H29N3O3
and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide |
| PubChem CID | 87018470 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(CCC)CC(=O)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C19H29N3O3/c1-3-10-20-18(23)13-22(11-4-2)14-19(24)21-16-9-12-25-17-8-6-5-7-15(16)17/h5-8,16H,3-4,9-14H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | LMWIHRNCAKGUHM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide?
The IUPAC name of 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide (CID 87018470) is 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide.
What is the SMILES notation for 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide?
The canonical SMILES for 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide is CCCNC(=O)CN(CCC)CC(=O)NC1CCOc2ccccc21.
What is the InChIKey of 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide?
The InChIKey is LMWIHRNCAKGUHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N3O3/c1-3-10-20-18(23)13-22(11-4-2)14-19(24)21-16-9-12-25-17-8-6-5-7-15(16)17/h5-8,16H,3-4,9-14H2,1-2H3,(H,20,23)(H,21,24).
What are the key properties of 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide?
2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide has a molecular weight of 347.46 g/mol, XLogP of 1.86, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl]-propylamino]-N-propylacetamide is sourced from PubChem (CID 87018470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).