C19H15N3O2 — CID 87018608
N-(1-benzofuran-2-ylmethyl)-5-phenyl-1H-pyrazole-4-carboxamide (PubChem CID 87018608) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-(1-benzofuran-2-ylmethyl)-5-phenyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(1-benzofuran-2-ylmethyl)-5-phenyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 87018608 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-(1-benzofuran-2-ylmethyl)-5-phenyl-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCc1cc2ccccc2o1)c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C19H15N3O2/c23-19(16-12-21-22-18(16)13-6-2-1-3-7-13)20-11-15-10-14-8-4-5-9-17(14)24-15/h1-10,12H,11H2,(H,20,23)(H,21,22) |
| InChIKey | UZSQYBQQGOVCOG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |