C16H17ClN4OS — CID 87018865
2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-(2-cyanoethyl)-N-ethylacetamide (PubChem CID 87018865) has the molecular formula C16H17ClN4OS and a molecular weight of 348.86 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-(2-cyanoethyl)-N-ethylacetamide.
| Compound Name | 2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-(2-cyanoethyl)-N-ethylacetamide |
|---|---|
| PubChem CID | 87018865 |
| Molecular Formula | C16H17ClN4OS |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-(2-cyanoethyl)-N-ethylacetamide |
| SMILES | CCN(CCC#N)C(=O)CSc1nccn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN4OS/c1-2-20(9-4-7-18)15(22)12-23-16-19-8-10-21(16)14-6-3-5-13(17)11-14/h3,5-6,8,10-11H,2,4,9,12H2,1H3 |
| InChIKey | AIDSKIIZRXMRFJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |