C19H26N4O4 — CID 87018972
N-cyclopentyl-N-cyclopropyl-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide (PubChem CID 87018972) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-cyclopentyl-N-cyclopropyl-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide.
| Compound Name | N-cyclopentyl-N-cyclopropyl-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
|---|---|
| PubChem CID | 87018972 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-cyclopentyl-N-cyclopropyl-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)N(C2CCCC2)C2CC2)c1=O |
| InChI | InChI=1S/C19H26N4O4/c1-3-11-20-17(25)21(12-4-2)19(27)22(18(20)26)13-16(24)23(15-9-10-15)14-7-5-6-8-14/h3-4,14-15H,1-2,5-13H2 |
| InChIKey | IUJGHQPZWMLLOY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|