C22H19N3O2 — CID 87019067
N-(3-acetamido-4-methylphenyl)-3H-benzo[e]indole-2-carboxamide (PubChem CID 87019067) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-(3-acetamido-4-methylphenyl)-3H-benzo[e]indole-2-carboxamide.
| Compound Name | N-(3-acetamido-4-methylphenyl)-3H-benzo[e]indole-2-carboxamide |
|---|---|
| PubChem CID | 87019067 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-(3-acetamido-4-methylphenyl)-3H-benzo[e]indole-2-carboxamide |
| SMILES | CC(=O)Nc1cc(NC(=O)c2cc3c(ccc4ccccc43)[nH]2)ccc1C |
| InChI | InChI=1S/C22H19N3O2/c1-13-7-9-16(11-20(13)23-14(2)26)24-22(27)21-12-18-17-6-4-3-5-15(17)8-10-19(18)25-21/h3-12,25H,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | ATFYOHHNSHQSQW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |