C22H31N3O3 — CID 87022719
N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-2-(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 87022719) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-2-(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-2-(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 87022719 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-2-(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1CCNC(=O)CN1C(=O)CN(C2CC2)C1=O |
| InChI | InChI=1S/C22H31N3O3/c1-14-10-16(22(3,4)5)11-15(2)18(14)8-9-23-19(26)12-25-20(27)13-24(21(25)28)17-6-7-17/h10-11,17H,6-9,12-13H2,1-5H3,(H,23,26) |
| InChIKey | PSKMLAFRBAROHQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|