C15H13ClN2O2S — CID 87022751
3-[(3-chloro-1-benzothiophen-2-yl)methyl]-1-cyclopropylimidazolidine-2,4-dione (PubChem CID 87022751) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is 3-[(3-chloro-1-benzothiophen-2-yl)methyl]-1-cyclopropylimidazolidine-2,4-dione.
| Compound Name | 3-[(3-chloro-1-benzothiophen-2-yl)methyl]-1-cyclopropylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87022751 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 3-[(3-chloro-1-benzothiophen-2-yl)methyl]-1-cyclopropylimidazolidine-2,4-dione |
| SMILES | O=C1CN(C2CC2)C(=O)N1Cc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C15H13ClN2O2S/c16-14-10-3-1-2-4-11(10)21-12(14)7-18-13(19)8-17(15(18)20)9-5-6-9/h1-4,9H,5-8H2 |
| InChIKey | BSZCKNBCCKPYLN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|