C18H16N4O3S — CID 87023234
N-[5-[2-cyano-3-oxo-3-(pyridin-2-ylamino)propanoyl]-4-methylthiophen-2-yl]cyclopropanecarboxamide (PubChem CID 87023234) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is N-[5-[2-cyano-3-oxo-3-(pyridin-2-ylamino)propanoyl]-4-methylthiophen-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[2-cyano-3-oxo-3-(pyridin-2-ylamino)propanoyl]-4-methylthiophen-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 87023234 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[5-[2-cyano-3-oxo-3-(pyridin-2-ylamino)propanoyl]-4-methylthiophen-2-yl]cyclopropanecarboxamide |
| SMILES | Cc1cc(NC(=O)C2CC2)sc1C(=O)C(C#N)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C18H16N4O3S/c1-10-8-14(22-17(24)11-5-6-11)26-16(10)15(23)12(9-19)18(25)21-13-4-2-3-7-20-13/h2-4,7-8,11-12H,5-6H2,1H3,(H,22,24)(H,20,21,25) |
| InChIKey | KTJAFJMEIPPVDE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|