C21H25N3O5 — CID 87023524
[5-[2-(4-methoxyphenoxy)ethyl-methylamino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone (PubChem CID 87023524) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is [5-[2-(4-methoxyphenoxy)ethyl-methylamino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-[2-(4-methoxyphenoxy)ethyl-methylamino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 87023524 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [5-[2-(4-methoxyphenoxy)ethyl-methylamino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone |
| SMILES | COc1ccc(OCCN(C)c2ccc([N+](=O)[O-])c(C(=O)N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C21H25N3O5/c1-22(13-14-29-18-8-6-17(28-2)7-9-18)16-5-10-20(24(26)27)19(15-16)21(25)23-11-3-4-12-23/h5-10,15H,3-4,11-14H2,1-2H3 |
| InChIKey | UUHGRPKMIVCCNK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|