C15H22BrNO3S — CID 87025496
N-[1-(2-bromophenyl)ethyl]-3-methylsulfonyl-N-propylpropanamide (PubChem CID 87025496) has the molecular formula C15H22BrNO3S and a molecular weight of 376.32 g/mol. Its IUPAC name is N-[1-(2-bromophenyl)ethyl]-3-methylsulfonyl-N-propylpropanamide.
| Compound Name | N-[1-(2-bromophenyl)ethyl]-3-methylsulfonyl-N-propylpropanamide |
|---|---|
| PubChem CID | 87025496 |
| Molecular Formula | C15H22BrNO3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-[1-(2-bromophenyl)ethyl]-3-methylsulfonyl-N-propylpropanamide |
| SMILES | CCCN(C(=O)CCS(C)(=O)=O)C(C)c1ccccc1Br |
| InChI | InChI=1S/C15H22BrNO3S/c1-4-10-17(15(18)9-11-21(3,19)20)12(2)13-7-5-6-8-14(13)16/h5-8,12H,4,9-11H2,1-3H3 |
| InChIKey | YDSVKZNIUCBXKH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |