C21H25FN2O2S — CID 87025690
2-(4-acetamidophenyl)sulfanyl-N-ethyl-N-[1-(4-fluorophenyl)ethyl]propanamide (PubChem CID 87025690) has the molecular formula C21H25FN2O2S and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)sulfanyl-N-ethyl-N-[1-(4-fluorophenyl)ethyl]propanamide.
| Compound Name | 2-(4-acetamidophenyl)sulfanyl-N-ethyl-N-[1-(4-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 87025690 |
| Molecular Formula | C21H25FN2O2S |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-(4-acetamidophenyl)sulfanyl-N-ethyl-N-[1-(4-fluorophenyl)ethyl]propanamide |
| SMILES | CCN(C(=O)C(C)Sc1ccc(NC(C)=O)cc1)C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN2O2S/c1-5-24(14(2)17-6-8-18(22)9-7-17)21(26)15(3)27-20-12-10-19(11-13-20)23-16(4)25/h6-15H,5H2,1-4H3,(H,23,25) |
| InChIKey | VAHRIEHCDAGJHJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |