C16H24N2O3S — CID 87028590
1-[4-(2,5-dimethylfuran-3-carbonyl)piperazin-1-yl]-3-ethylsulfanylpropan-1-one (PubChem CID 87028590) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-[4-(2,5-dimethylfuran-3-carbonyl)piperazin-1-yl]-3-ethylsulfanylpropan-1-one.
| Compound Name | 1-[4-(2,5-dimethylfuran-3-carbonyl)piperazin-1-yl]-3-ethylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 87028590 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-[4-(2,5-dimethylfuran-3-carbonyl)piperazin-1-yl]-3-ethylsulfanylpropan-1-one |
| SMILES | CCSCCC(=O)N1CCN(C(=O)c2cc(C)oc2C)CC1 |
| InChI | InChI=1S/C16H24N2O3S/c1-4-22-10-5-15(19)17-6-8-18(9-7-17)16(20)14-11-12(2)21-13(14)3/h11H,4-10H2,1-3H3 |
| InChIKey | CIFKTYFKBPZDFP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|