C18H19N3O3 — CID 87029682
2-[[3-(2-methoxyethoxy)anilino]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 87029682) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-[[3-(2-methoxyethoxy)anilino]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[3-(2-methoxyethoxy)anilino]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 87029682 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[[3-(2-methoxyethoxy)anilino]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | COCCOc1cccc(NCc2cc(=O)n3ccccc3n2)c1 |
| InChI | InChI=1S/C18H19N3O3/c1-23-9-10-24-16-6-4-5-14(11-16)19-13-15-12-18(22)21-8-3-2-7-17(21)20-15/h2-8,11-12,19H,9-10,13H2,1H3 |
| InChIKey | NNNMSEBYZBAHJJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|