C26H37N3O2 — CID 87029790
N-[3-[4-(4-methylphenyl)-1,4-diazepan-1-yl]-3-oxopropyl]adamantane-1-carboxamide (PubChem CID 87029790) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is N-[3-[4-(4-methylphenyl)-1,4-diazepan-1-yl]-3-oxopropyl]adamantane-1-carboxamide.
| Compound Name | N-[3-[4-(4-methylphenyl)-1,4-diazepan-1-yl]-3-oxopropyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 87029790 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | N-[3-[4-(4-methylphenyl)-1,4-diazepan-1-yl]-3-oxopropyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(N2CCCN(C(=O)CCNC(=O)C34CC5CC(CC(C5)C3)C4)CC2)cc1 |
| InChI | InChI=1S/C26H37N3O2/c1-19-3-5-23(6-4-19)28-9-2-10-29(12-11-28)24(30)7-8-27-25(31)26-16-20-13-21(17-26)15-22(14-20)18-26/h3-6,20-22H,2,7-18H2,1H3,(H,27,31) |
| InChIKey | RKUAEOJMKFRDMM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|