C16H17BrN2O3 — CID 87030481
2-(5-bromo-2-methoxyanilino)-N-(2-methoxyphenyl)acetamide (PubChem CID 87030481) has the molecular formula C16H17BrN2O3 and a molecular weight of 365.23 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyanilino)-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-(5-bromo-2-methoxyanilino)-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 87030481 |
| Molecular Formula | C16H17BrN2O3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 2-(5-bromo-2-methoxyanilino)-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccc(Br)cc1NCC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C16H17BrN2O3/c1-21-14-6-4-3-5-12(14)19-16(20)10-18-13-9-11(17)7-8-15(13)22-2/h3-9,18H,10H2,1-2H3,(H,19,20) |
| InChIKey | GJKDSGBFLKUCSR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |