C21H22N2O4S — CID 87032975
4-ethoxy-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzenesulfonamide (PubChem CID 87032975) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 4-ethoxy-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87032975 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-ethoxy-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCc2ccc(OCc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C21H22N2O4S/c1-2-26-19-10-12-21(13-11-19)28(24,25)23-15-17-6-8-20(9-7-17)27-16-18-5-3-4-14-22-18/h3-14,23H,2,15-16H2,1H3 |
| InChIKey | MXQFTNRSAYOVLP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |