C15H21N5O2 — CID 87033202
3-tert-butyl-1-methyl-N'-(1-methylpyrrole-2-carbonyl)pyrazole-5-carbohydrazide (PubChem CID 87033202) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-tert-butyl-1-methyl-N'-(1-methylpyrrole-2-carbonyl)pyrazole-5-carbohydrazide.
| Compound Name | 3-tert-butyl-1-methyl-N'-(1-methylpyrrole-2-carbonyl)pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 87033202 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 3-tert-butyl-1-methyl-N'-(1-methylpyrrole-2-carbonyl)pyrazole-5-carbohydrazide |
| SMILES | Cn1cccc1C(=O)NNC(=O)c1cc(C(C)(C)C)nn1C |
| InChI | InChI=1S/C15H21N5O2/c1-15(2,3)12-9-11(20(5)18-12)14(22)17-16-13(21)10-7-6-8-19(10)4/h6-9H,1-5H3,(H,16,21)(H,17,22) |
| InChIKey | CSTCNPGXFNKACD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|