C20H26N2O4S — CID 87034684
1-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[[4-(methylsulfonylmethyl)phenyl]methyl]urea (PubChem CID 87034684) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[[4-(methylsulfonylmethyl)phenyl]methyl]urea.
| Compound Name | 1-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[[4-(methylsulfonylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 87034684 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-methyl-1-[2-(4-methylphenoxy)ethyl]-3-[[4-(methylsulfonylmethyl)phenyl]methyl]urea |
| SMILES | Cc1ccc(OCCN(C)C(=O)NCc2ccc(CS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H26N2O4S/c1-16-4-10-19(11-5-16)26-13-12-22(2)20(23)21-14-17-6-8-18(9-7-17)15-27(3,24)25/h4-11H,12-15H2,1-3H3,(H,21,23) |
| InChIKey | UVQWREKEGNOOLF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |