About 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide
5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide (PubChem CID 87035340) has the molecular formula C12H16N6O
and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide.
Molecular Properties
| Compound Name | 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide |
| PubChem CID | 87035340 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide |
| SMILES | CC(C)Cc1cc(C(=O)NNc2ncccn2)n[nH]1 |
| InChI | InChI=1S/C12H16N6O/c1-8(2)6-9-7-10(16-15-9)11(19)17-18-12-13-4-3-5-14-12/h3-5,7-8H,6H2,1-2H3,(H,15,16)(H,17,19)(H,13,14,18) |
| InChIKey | VKINUQKNHPZVBO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide?
The IUPAC name of 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide (CID 87035340) is 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide.
What is the SMILES notation for 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide?
The canonical SMILES for 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide is CC(C)Cc1cc(C(=O)NNc2ncccn2)n[nH]1.
What is the InChIKey of 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide?
The InChIKey is VKINUQKNHPZVBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N6O/c1-8(2)6-9-7-10(16-15-9)11(19)17-18-12-13-4-3-5-14-12/h3-5,7-8H,6H2,1-2H3,(H,15,16)(H,17,19)(H,13,14,18).
What are the key properties of 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide?
5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide has a molecular weight of 260.30 g/mol, XLogP of 1.16, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylpropyl)-N'-pyrimidin-2-yl-1H-pyrazole-3-carbohydrazide is sourced from PubChem (CID 87035340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).