C20H31N3O3 — CID 87036562
4-N,4-N-dimethyl-1-N-[3-(2-phenylethoxy)propyl]piperidine-1,4-dicarboxamide (PubChem CID 87036562) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-[3-(2-phenylethoxy)propyl]piperidine-1,4-dicarboxamide.
| Compound Name | 4-N,4-N-dimethyl-1-N-[3-(2-phenylethoxy)propyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 87036562 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-[3-(2-phenylethoxy)propyl]piperidine-1,4-dicarboxamide |
| SMILES | CN(C)C(=O)C1CCN(C(=O)NCCCOCCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H31N3O3/c1-22(2)19(24)18-9-13-23(14-10-18)20(25)21-12-6-15-26-16-11-17-7-4-3-5-8-17/h3-5,7-8,18H,6,9-16H2,1-2H3,(H,21,25) |
| InChIKey | PEIRCRDIVISZSN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|