About N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide
N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide (PubChem CID 870369) has the molecular formula C15H12N2O5
and a molecular weight of 300.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide |
| PubChem CID | 870369 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12N2O5/c18-15(11-2-1-3-12(7-11)17(19)20)16-8-10-4-5-13-14(6-10)22-9-21-13/h1-7H,8-9H2,(H,16,18) |
| InChIKey | BTXXRLKNENYEPI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide?
The IUPAC name of N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide (CID 870369) is N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide.
What is the SMILES notation for N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide?
The canonical SMILES for N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide is O=C(NCc1ccc2c(c1)OCO2)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide?
The InChIKey is BTXXRLKNENYEPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O5/c18-15(11-2-1-3-12(7-11)17(19)20)16-8-10-4-5-13-14(6-10)22-9-21-13/h1-7H,8-9H2,(H,16,18).
What are the key properties of N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide?
N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide has a molecular weight of 300.27 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-ylmethyl)-3-nitrobenzamide is sourced from PubChem (CID 870369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).