C19H25N5O2 — CID 87039966
N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-2-(4-ethylpiperazin-1-yl)-2-oxoacetamide (PubChem CID 87039966) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-2-(4-ethylpiperazin-1-yl)-2-oxoacetamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-2-(4-ethylpiperazin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 87039966 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)phenyl]-2-(4-ethylpiperazin-1-yl)-2-oxoacetamide |
| SMILES | CCN1CCN(C(=O)C(=O)Nc2cccc(-n3nc(C)cc3C)c2)CC1 |
| InChI | InChI=1S/C19H25N5O2/c1-4-22-8-10-23(11-9-22)19(26)18(25)20-16-6-5-7-17(13-16)24-15(3)12-14(2)21-24/h5-7,12-13H,4,8-11H2,1-3H3,(H,20,25) |
| InChIKey | SWNCCTRANJKZEI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|