C16H19N3O4 — CID 87040056
methyl (2S)-2-[(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)amino]propanoate (PubChem CID 87040056) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is methyl (2S)-2-[(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 87040056 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl (2S)-2-[(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)c1nn(C(C)C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C16H19N3O4/c1-9(2)19-15(21)12-8-6-5-7-11(12)13(18-19)14(20)17-10(3)16(22)23-4/h5-10H,1-4H3,(H,17,20)/t10-/m0/s1 |
| InChIKey | KGYJCKYHOCUPRY-JTQLQIEISA-N |
| XLogP | 1.27 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |